A5592612
4-Morpholinylcarbonyl Chloride , 97% , 15159-40-7
CAS NO.：15159-40-7
Empirical Formula: C5H8ClNO2
Molecular Weight: 149.58
MDL number: MFCD00037053
EINECS: 239-213-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB43.20 | In Stock |
|
| 10g | RMB143.20 | In Stock |
|
| 25G | RMB158.40 | In Stock |
|
| 100G | RMB599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 137-138 °C/33 mmHg (lit.) |
| Density | 1.282 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| pka | -2.16±0.20(Predicted) |
| color | Colorless to Light yellow |
| BRN | 116257 |
| InChI | InChI=1S/C5H8ClNO2/c6-5(8)7-1-3-9-4-2-7/h1-4H2 |
| InChIKey | XMWFMEYDRNJSOO-UHFFFAOYSA-N |
| SMILES | C(Cl)(N1CCOCC1)=O |
| CAS DataBase Reference | 15159-40-7(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Morpholinecarbonyl chloride (15159-40-7) |
Description and Uses
Photographic intermediate
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H351 |
| Precautionary statements | P201-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 14-36/38-40 |
| Safety Statements | 26-30-36-38 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29349990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
