A5596212
4-Methoxybiphenyl , >99.0%(GC) , 613-37-6
Synonym(s):
4-Phenylanisole
CAS NO.：613-37-6
Empirical Formula: C13H12O
Molecular Weight: 184.23
MDL number: MFCD00014897
EINECS: 210-339-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB238.40 | In Stock |
|
| 100g | RMB1160.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-90 °C(lit.) |
| Boiling point: | 157 °C (10 mmHg) |
| Density | 1.0278 |
| refractive index | 1.5744 (estimate) |
| Flash point: | 157°C/10mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder, crystals or chunks |
| color | Leaves or plates from alc |
| BRN | 2043157 |
| InChI | InChI=1S/C13H12O/c1-14-13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | RHDYQUZYHZWTCI-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(OC)C=C1 |
| CAS DataBase Reference | 613-37-6(CAS DataBase Reference) |
| NIST Chemistry Reference | P-phenylanisole(613-37-6) |
| EPA Substance Registry System | 1,1'-Biphenyl, 4-methoxy- (613-37-6) |
Description and Uses
4-Methoxybiphenyl is a useful intermediate in the preparation of biphenyl derivatives which are potential downregulators of VEGF protein secretion and telomerase-related gene expressions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | BZ8850000 |
| TSCA | Yes |
| HS Code | 2909.30.6000 |
| HazardClass | IRRITANT |
| Hazardous Substances Data | 613-37-6(Hazardous Substances Data) |
