A5597912
2-(<i>m</i>-Tolyl)ethanol , 98% , 1875-89-4
CAS NO.:1875-89-4
Empirical Formula: C9H12O
Molecular Weight: 136.19
MDL number: MFCD00002896
EINECS: 217-508-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB81.60 | In Stock |
|
| 5G | RMB262.40 | In Stock |
|
| 25G | RMB887.20 | In Stock |
|
| 100g | RMB3039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 242-243 °C (lit.) |
| Density | 1.002 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 229 °F |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 14.97±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Odor | at 100.00 %. floral rose jasmin muguet lilac woody |
| Odor Type | floral |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | InChI=1S/C9H12O/c1-8-3-2-4-9(7-8)5-6-10/h2-4,7,10H,5-6H2,1H3 |
| InChIKey | KWHVBVJDKLSOTB-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=CC(C)=C1 |
| LogP | 2.055 (est) |
| CAS DataBase Reference | 1875-89-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneethanol, 3-methyl-(1875-89-4) |
| EPA Substance Registry System | 3-Methylbenzeneethanol (1875-89-4) |
Description and Uses
3-Methylphenethyl alcohol (2-(3-methylphenyl) ethanol) is commonly used as fragrance ingredient.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29062990 |
| Storage Class | 10 - Combustible liquids |



