A5600512
3-Methyl-2-thiophenecarboxylic Acid , >98.0% , 23806-24-8
CAS NO.:23806-24-8
Empirical Formula: C6H6O2S
Molecular Weight: 142.18
MDL number: MFCD00005438
EINECS: 245-894-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB76.00 | In Stock |
|
| 10g | RMB129.60 | In Stock |
|
| 25G | RMB211.20 | In Stock |
|
| 100G | RMB679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-149 °C(lit.) |
| Boiling point: | 229.75°C (rough estimate) |
| Density | 1.365 (estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | 2-8°C(protect from light) |
| form | solid |
| pka | 3.68±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 116184 |
| InChI | InChI=1S/C6H6O2S/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3,(H,7,8) |
| InChIKey | IFLKEBSJTZGCJG-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)SC=CC=1C |
| CAS DataBase Reference | 23806-24-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Methyl-2-thiophenecarboxylic acid(23806-24-8) |
Description and Uses
3-Methyl-2-thiophenecarboxylic acid has been used in the synthesis of zinc and cadmium carboxylate complexes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |




