A5600712
Methyl 3-(Chlorosulfonyl)-2-thiophenecarboxylate , ≥90.0% , 59337-92-7
CAS NO.：59337-92-7
Empirical Formula: C6H5ClO4S2
Molecular Weight: 240.68
MDL number: MFCD00068160
EINECS: 627-732-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB72.00 | In Stock |
|
| 100G | RMB213.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-64 °C(lit.) |
| Boiling point: | 364.8±27.0 °C(Predicted) |
| Density | 1.568±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Toluene |
| form | Crystalline Powder |
| color | White to brown |
| Stability: | Moisture Sensitive |
| InChI | 1S/C6H5ClO4S2/c1-11-6(8)5-4(2-3-12-5)13(7,9)10/h2-3H,1H3 |
| InChIKey | PJVJBDAUWILEOG-UHFFFAOYSA-N |
| SMILES | COC(=O)c1sccc1S(Cl)(=O)=O |
| CAS DataBase Reference | 59337-92-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Thiophenecarboxylic acid, 3-(chlorosulfonyl)-, methyl ester (59337-92-7) |
Description and Uses
2-Carbomethoxy-3-thiophenesulfonyl chloride is widely employed as a sulfonylating reagent. It can be prepared from methyl 3-amino-2-thiophenecarboxylate.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
