A5606112
Methyl 3-Bromobenzoate , >99.0%(GC) , 618-89-3
CAS NO.:618-89-3
Empirical Formula: C8H7BrO2
Molecular Weight: 215.04
MDL number: MFCD00017777
EINECS: 210-569-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.00 | In Stock |
|
| 5G | RMB60.00 | In Stock |
|
| 25G | RMB212.00 | In Stock |
|
| 50g | RMB295.20 | In Stock |
|
| 100G | RMB637.60 | In Stock |
|
| 250g | RMB2399.20 | In Stock |
|
| 500g | RMB2836.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 31-33 °C(lit.) |
| Boiling point: | 127-128 °C15 mm Hg(lit.) |
| Density | 1.5313 (rough estimate) |
| refractive index | 1.5575 |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Solid or Liquid |
| color | White to light yellow |
| Water Solubility | Slightly soluble in water. |
| BRN | 1940810 |
| InChI | InChI=1S/C8H7BrO2/c1-11-8(10)6-3-2-4-7(9)5-6/h2-5H,1H3 |
| InChIKey | KMFJVYMFCAIRAN-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC(Br)=C1 |
| CAS DataBase Reference | 618-89-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 3-bromo-, methyl ester(618-89-3) |
| EPA Substance Registry System | Benzoic acid, 3-bromo-, methyl ester (618-89-3) |
Description and Uses
Methyl 3-bromobenzoate is an halogenated benzoate derivative used as a reagent in organic synthesis.Methyl 3-bromobenzoate is used in the synthesis of a novel series of tetrahydro dibenzazocine as inhibitors of 17β-hydroxysteroid dehydrogenase type 3.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H331-H315-H319-H335 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P310+P330-P304+P340+P311-P403+P233-P405 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29163990 |





