A5606612
Methyl 2-Chlorobenzoate , >98.0%(GC) , 610-96-8
CAS NO.：610-96-8
Empirical Formula: C8H7ClO2
Molecular Weight: 170.59
MDL number: MFCD00016337
EINECS: 210-242-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB64.00 | In Stock |
|
| 100G | RMB176.00 | In Stock |
|
| 500G | RMB695.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 233-235 °C |
| Boiling point: | 233-235 °C |
| Density | 1.191 g/mL at 25 °C(lit.) |
| refractive index | 1.5351-1.537 |
| Flash point: | 108 °C |
| storage temp. | Store below +30°C. |
| form | Liquid |
| Specific Gravity | 1.191 |
| color | Clear colorless |
| BRN | 1364684 |
| InChI | InChI=1S/C8H7ClO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
| InChIKey | JAVRNIFMYIJXIE-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC=C1Cl |
| CAS DataBase Reference | 610-96-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 6-Chlorobenzoic acid, methyl ester(610-96-8) |
| EPA Substance Registry System | Methyl-2-chlorobenzoate (610-96-8) |
Description and Uses
Methyl 2-chlorobenzoate may be used in the synthesis of various quinazolinone derivatives. It was used as starting reagent in the synthesis of 2-chlorobenzohydrazide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
