PRODUCT Properties
| Melting point: | 38-41℃ |
| Boiling point: | 282°C(lit.) |
| Density | 1.0340 |
| refractive index | 1.6070 (estimate) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 3.28±0.17(Predicted) |
| color | White to Orange to Green |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C10H9NO/c1-12-9-6-2-4-8-5-3-7-11-10(8)9/h2-7H,1H3 |
| InChIKey | ZLKGGEBOALGXJZ-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2OC)C=CC=1 |
Description and Uses
8-Methoxyquinoline is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| HS Code | 2933499090 |
