A5616812
4-Methylcarbostyril , >98.0%(HPLC) , 607-66-9
Synonym(s):
4-Methyl-2-quinolinol;4-Methylcarbostyril
CAS NO.:607-66-9
Empirical Formula: C10H9NO
Molecular Weight: 159.18
MDL number: MFCD00006745
EINECS: 210-139-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB151.20 | In Stock |
|
| 100g | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 221-223 °C (lit.) |
| Boiling point: | 284.68°C (rough estimate) |
| Density | 1.1202 (rough estimate) |
| refractive index | 1.6070 (estimate) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 11.83±0.70(Predicted) |
| color | White to Almost white |
| BRN | 118331 |
| InChI | InChI=1S/C10H9NO/c1-7-6-10(12)11-9-5-3-2-4-8(7)9/h2-6H,1H3,(H,11,12) |
| InChIKey | APLVPBUBDFWWAD-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(C)=CC1=O |
| CAS DataBase Reference | 607-66-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-22-36/37/39 |
| WGK Germany | 3 |
| HS Code | 29334990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![6-Bromo-3-methyl-3H-naphtho[1,2,3-de]quinoline-2,7-dione](https://img.chemicalbook.com/CAS/GIF/81-85-6.gif)
