A5622012
Methyl 3-Methyl-2-nitrobenzoate , >98.0%(GC) , 5471-82-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB43.20 | In Stock |
|
| 100G | RMB126.40 | In Stock |
|
| 500g | RMB535.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-73°C |
| Boiling point: | 286.3±20.0 °C(Predicted) |
| Density | 1+-.0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Solid |
| color | White to Almost white |
| InChI | InChI=1S/C9H9NO4/c1-6-4-3-5-7(9(11)14-2)8(6)10(12)13/h3-5H,1-2H3 |
| InChIKey | NJHDBIXFFZVJGZ-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC(C)=C1[N+]([O-])=O |
| CAS DataBase Reference | 5471-82-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 3-methyl-2-nitro-, methyl ester (5471-82-9) |
Description and Uses
Methyl 3-methyl-2-nitrobenzoate is used as a raw material for the synthesis of pesticide intermediate 2-amino-5-chloro-N,3-dimethylbenzamide, and is hydrogenated to produce 2-amino-3-methylbenzoic acid methyl ester.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |







