A5624412
Methyl (4-Chlorophenyl)acetate , >98.0%(GC) , 52449-43-1
CAS NO.：52449-43-1
Empirical Formula: C9H9ClO2
Molecular Weight: 184.62
MDL number: MFCD00032743
EINECS: 257-927-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5G | RMB65.60 | In Stock |
|
| 10g | RMB66.88 | In Stock |
|
| 25G | RMB180.80 | In Stock |
|
| 100G | RMB503.20 | In Stock |
|
| 500g | RMB1428.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 115 °C / 6mmHg |
| Density | 1.20 |
| refractive index | 1.522-1.524 |
| Flash point: | 250 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, DCM, Methanol |
| form | Liquid |
| color | Clear slightly yellow |
| InChI | InChI=1S/C9H9ClO2/c1-12-9(11)6-7-2-4-8(10)5-3-7/h2-5H,6H2,1H3 |
| InChIKey | WWIYGBWRUXQDND-UHFFFAOYSA-N |
| SMILES | C1(CC(OC)=O)=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 52449-43-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneacetic acid, 4-chloro-, methyl ester(52449-43-1) |
Description and Uses
(4-Chlorophenyl)acetic Acid Methyl Ester is an intermediate in the synthesis of 4-Chloro-N-(2-hydroxypropyl)benzeneacetamide (C368125), a reagent in the synthesis of Lorcaserin Hydrochloride (L469890).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36/37/39 |
| HS Code | 29420000 |
