A5629512
2-(4-Methoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine , >98.0%(HPLC) , 42573-57-9
CAS NO.:42573-57-9
Empirical Formula: C14H9Cl6N3O
Molecular Weight: 447.96
MDL number: MFCD01940892
EINECS: 255-893-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB83.20 | In Stock |
|
| 5G | RMB367.20 | In Stock |
|
| 25G | RMB1652.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192-195 °C (lit.) |
| Boiling point: | 511.4±60.0 °C(Predicted) |
| Density | 1.605 |
| pka | -1.88±0.10(Predicted) |
| form | powder to crystal |
| color | Light yellow to Amber to Dark green |
| λmax | 379 nm |
| InChI | InChI=1S/C14H9Cl6N3O/c1-24-9-5-2-8(3-6-9)4-7-10-21-11(13(15,16)17)23-12(22-10)14(18,19)20/h2-7H,1H3 |
| InChIKey | MCNPOZMLKGDJGP-UHFFFAOYSA-N |
| SMILES | N1=C(C(Cl)(Cl)Cl)N=C(C(Cl)(Cl)Cl)N=C1C=CC1=CC=C(OC)C=C1 |
| EPA Substance Registry System | 1,3,5-Triazine, 2-[2-(4-methoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)- (42573-57-9) |
Description and Uses
Cationic photoinitiator. Nonionic photoacid generator.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29336990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







