A5629612
4'-Methoxybutyrophenone , >98.0%(GC) , 4160-51-4
CAS NO.：4160-51-4
Empirical Formula: C11H14O2
Molecular Weight: 178.23
MDL number: MFCD00027138
EINECS: 223-995-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB150.40 | In Stock |
|
| 25g | RMB639.20 | In Stock |
|
| 100g | RMB2383.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 22 °C |
| Boiling point: | 124-128 °C (4 mmHg) |
| Density | 1.0292 (rough estimate) |
| refractive index | 1.5378-1.5398 |
| Flash point: | 124-128°C/4mm |
| storage temp. | Store at room temperature |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| BRN | 908286 |
| InChI | InChI=1S/C11H14O2/c1-3-4-11(12)9-5-7-10(13-2)8-6-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | JLCDSZXBELPBRD-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(OC)C=C1)(=O)CCC |
| CAS DataBase Reference | 4160-51-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-(4-Methoxyphenyl)-1-butanone(4160-51-4) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| HazardClass | IRRITANT |
| HS Code | 2914409000 |
