A5633512
4-(Methylsulfonyl)benzoic Acid , 98% , 4052-30-6
CAS NO.：4052-30-6
Empirical Formula: C8H8O4S
Molecular Weight: 200.21
MDL number: MFCD00007564
EINECS: 223-756-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB15.20 | In Stock |
|
| 5G | RMB29.60 | In Stock |
|
| 25G | RMB84.80 | In Stock |
|
| 100G | RMB271.20 | In Stock |
|
| 500g | RMB1156.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 268-271 °C(lit.) |
| Boiling point: | 307.93°C (rough estimate) |
| Density | 1.4787 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | slight |
| pka | pK1:3.64 (25°C) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | slight |
| InChI | 1S/C8H8O4S/c1-13(11,12)7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10) |
| InChIKey | AJBWNNKDUMXZLM-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(cc1)C(O)=O |
| CAS DataBase Reference | 4052-30-6(CAS DataBase Reference) |
Description and Uses
4-(Methylsulfonyl)benzoic acid has pKa value of 3.48 and 8.36 in water and methanol at 25°C.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H302-H319 |
| Precautionary statements | P261-P280a-P304+P340-P405-P501a-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22 |
| Safety Statements | 24/25-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29163100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
