A5633712
2-Methyl-3-nitrobenzoic Acid , ≥98.0% , 1975-50-4
Synonym(s):
3-Nitro-o-toluic acid
CAS NO.:1975-50-4
Empirical Formula: C8H7NO4
Molecular Weight: 181.15
MDL number: MFCD00007160
EINECS: 217-826-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB92.00 | In Stock |
|
| 250g | RMB143.20 | In Stock |
|
| 500G | RMB235.20 | In Stock |
|
| 2.5kg | RMB1167.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182-184 °C (lit.) |
| Boiling point: | 314.24°C (rough estimate) |
| Density | 1.4283 (rough estimate) |
| refractive index | 1.5468 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.03±0.20(Predicted) |
| color | White to Light red to Green |
| Water Solubility | <0.1 g/100 mL at 22 ºC |
| BRN | 2050096 |
| InChI | InChI=1S/C8H7NO4/c1-5-6(8(10)11)3-2-4-7(5)9(12)13/h2-4H,1H3,(H,10,11) |
| InChIKey | YPQAFWHSMWWPLX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC([N+]([O-])=O)=C1C |
| CAS DataBase Reference | 1975-50-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Methyl-3-nitrobenzoic acid (1975-50-4) |
Description and Uses
3-Nitro-o-toluic Acid, is a building block used for the synthesis of various compounds. It is an intermediate for the synthesis of 4-(Piperazin-1-ylmethyl)-N1-arylsulfonyl indole derivatives as 5-HT6 receptor ligands.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39-22 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |





