A5633812
4-Methyl-3-nitrobenzoic Acid , ≥99.0% , 96-98-0
Synonym(s):
3-Nitro-p-toluic acid
CAS NO.:96-98-0
Empirical Formula: C8H7NO4
Molecular Weight: 181.15
MDL number: MFCD00007174
EINECS: 202-549-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB39.20 | In Stock |
|
| 100G | RMB88.00 | In Stock |
|
| 500G | RMB378.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 187-190 °C (lit.) |
| Boiling point: | 314.24°C (rough estimate) |
| Density | 1.4283 (rough estimate) |
| vapor pressure | 0.001Pa at 20℃ |
| refractive index | 1.5468 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 0.257g/l |
| pka | 3.66±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to light yellow |
| Water Solubility | <0.1 g/100 mL at 22 ºC |
| BRN | 1874411 |
| InChI | 1S/C8H7NO4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4H,1H3,(H,10,11) |
| InChIKey | BBEWSMNRCUXQRF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1[N+]([O-])=O)C(O)=O |
| LogP | 1.65 at 23℃ and pH6.3-6.7 |
| CAS DataBase Reference | 96-98-0(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Methyl-3-nitrobenzoic acid (96-98-0) |
Description and Uses
4-Methyl-3-nitrobenzoic acid was used in the synthesis of one-dimensional (1D) lanthanide coordination complexes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22-22 |
| Safety Statements | 36/37/39-26-22-36-24/25 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |





