A5646812
6-Methyl-4-phenyl-2-chromanone , >98.0% , 40546-94-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB25.60 | In Stock |
|
| 1g | RMB65.60 | In Stock |
|
| 5G | RMB180.80 | In Stock |
|
| 25G | RMB551.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-70°C |
| Boiling point: | 230°C/16mmHg(lit.) |
| Density | 1.166±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical |
| InChI | 1S/C16H14O2/c1-11-7-8-15-14(9-11)13(10-16(17)18-15)12-5-3-2-4-6-12/h2-9,13H,10H2,1H3 |
| InChIKey | SUHIZPDCJOQZLN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O2)C(C(C3=CC=CC=C3)CC2=O)=C1 |
| CAS DataBase Reference | 40546-94-9(CAS DataBase Reference) |
Description and Uses
Intermediate in the production of Tolterodine.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P501-P264-P280-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P405 |
| WGK Germany | WGK 3 |
| HS Code | 2932.20.4500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |




