A5648612
Methyl <i>p</i>-Tolyl Sulfone , >98.0%(GC) , 3185-99-7
Synonym(s):
Methyl p-tolyl sulfone
CAS NO.:3185-99-7
Empirical Formula: C8H10O2S
Molecular Weight: 170.23
MDL number: MFCD00014742
EINECS: 221-682-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB24.00 | In Stock |
|
| 100G | RMB64.00 | In Stock |
|
| 250g | RMB95.20 | In Stock |
|
| 500G | RMB196.00 | In Stock |
|
| 2.5kg | RMB863.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-89 °C(lit.) |
| Boiling point: | 140 °C / 3mmHg |
| Density | 1.2238 (rough estimate) |
| refractive index | 1.5320 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 607296 |
| InChI | InChI=1S/C8H10O2S/c1-7-3-5-8(6-4-7)11(2,9)10/h3-6H,1-2H3 |
| InChIKey | YYDNBUBMBZRNQQ-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(S(C)(=O)=O)C=C1 |
| CAS DataBase Reference | 3185-99-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-methyl-4-(methylsulfonyl)-(3185-99-7) |
| EPA Substance Registry System | Benzene, 1-methyl-4-(methylsulfonyl)- (3185-99-7) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,F |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 1 |
| HazardClass | IRRITANT |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








