A5648712
Methyl Phenylsulfonylacetate , 95% , 34097-60-4
Synonym(s):
Methyl benzenesulfonylacetate
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB86.40 | In Stock |
|
| 25G | RMB317.60 | In Stock |
|
| 100G | RMB1207.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 30°C |
| Boiling point: | 165 °C/0.05 mmHg (lit.) |
| Density | 1.305 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid to slightly cloudy liquid |
| Specific Gravity | 1.282 |
| color | Light orange to Yellow to Green |
| Water Solubility | Insoluble in water. |
| BRN | 2051463 |
| InChI | InChI=1S/C9H10O4S/c1-13-9(10)7-14(11,12)8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | NLEAIFBNKPYTGN-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CS(C1=CC=CC=C1)(=O)=O |
| CAS DataBase Reference | 34097-60-4(CAS DataBase Reference) |
Description and Uses
Methyl phenylsulfonylacetate has been used in a key step during the synthesis of (-)-hybridalactone, marine eicosanoid isolated from the red alga Laurencia hybrida, in dehydrative alkylation of alcohols under modified Mitsunobu conditions followed by desulfonylation using magnesium, in three step synthesis of 2-(hydroxymethyl)indene.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P403+P235-P501 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Risk Statements | 10 |
| Safety Statements | 23-24/25-43-36/37/39-15/16 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 10 - Combustible liquids |





