A5656712
2-Methyl-4(5)-nitroimidazole , >99.0% , 696-23-1
Synonym(s):
2-Methyl-4(5)-nitroimidazole;2-METHYL-5-NITROIMIDAZOLE;Metronidazole Impurity A
CAS NO.：696-23-1
Empirical Formula: C4H5N3O2
Molecular Weight: 127.1
MDL number: MFCD00005191
EINECS: 211-790-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB26.40 | In Stock |
|
| 25G | RMB41.60 | In Stock |
|
| 50g | RMB55.20 | In Stock |
|
| 100G | RMB102.40 | In Stock |
|
| 250g | RMB191.20 | In Stock |
|
| 500G | RMB371.20 | In Stock |
|
| 2.5kg | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 251-255 °C(lit.) |
| Boiling point: | 235.85°C (rough estimate) |
| Density | 1.4748 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| Flash point: | 195℃ |
| storage temp. | 2-8°C |
| solubility | DMSO (Sparingly), Methanol (Sparingly) |
| form | powder |
| pka | 8.87±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Water Solubility | 3.01g/L(20 ºC) |
| BRN | 4032 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C4H5N3O2/c1-3-5-2-4(6-3)7(8)9/h2H,1H3,(H,5,6) |
| InChIKey | FFYTTYVSDVWNMY-UHFFFAOYSA-N |
| SMILES | Cc1ncc([nH]1)[N+]([O-])=O |
| CAS DataBase Reference | 696-23-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Imidazole, 2-methyl-4-nitro- (696-23-1) |
Description and Uses
2-Methyl-4(5)-nitroimidazole was used to study the mechanism of both the alkaline and acidic hydrolysis of tinidazole.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 68-40-22 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| RTECS | NI7550000 |
| TSCA | TSCA listed |
| HS Code | 2933290000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
