A5657712
Methyl 3-Furancarboxylate , >96.0%(GC) , 13129-23-2
CAS NO.：13129-23-2
Empirical Formula: C6H6O3
Molecular Weight: 126.11
MDL number: MFCD06203671
EINECS: 215-614-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB559.20 | In Stock |
|
| 25G | RMB1871.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-67 °C |
| Boiling point: | 64°C/4mmHg |
| Density | 1.17 |
| refractive index | 1.4670 to 1.4700 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C6H6O3/c1-8-6(7)5-2-3-9-4-5/h2-4H,1H3 |
| InChIKey | ZKHQSQYLKSSYIP-UHFFFAOYSA-N |
| SMILES | O1C=CC(C(OC)=O)=C1 |
| CAS DataBase Reference | 13129-23-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Furancarboxylic acid, methyl ester(13129-23-2) |
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P280-P370+P378-P303+P361+P353-P403+P235 |
| RIDADR | UN 3272 3/PG III |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2932190090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
