A5659312
Methyl 2-Oxoindoline-6-carboxylate , >98.0% , 14192-26-8
CAS NO.:14192-26-8
Empirical Formula: C10H9NO3
Molecular Weight: 191.18
MDL number: MFCD03095196
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB38.40 | In Stock |
|
| 5G | RMB86.40 | In Stock |
|
| 25g | RMB318.40 | In Stock |
|
| 100g | RMB1038.40 | In Stock |
|
| 500g | RMB4150.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184-190°C |
| Boiling point: | 388.1±42.0 °C(Predicted) |
| Density | 1.283±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 13.50±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C10H9NO3/c1-14-10(13)7-3-2-6-5-9(12)11-8(6)4-7/h2-4H,5H2,1H3,(H,11,12) |
| InChIKey | YFTGUNWFFVDLNM-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(C(OC)=O)=C2)CC1=O |
| CAS DataBase Reference | 14192-26-8(CAS DataBase Reference) |
Description and Uses
Methyl Oxindole-6-carboxylate is an intermediate used to prepare BIBF 1120, an indolinone as triple angiokinase inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HS Code | 2933790090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |







