A5662612
4-(4-Methoxyphenyl)butyric Acid , >95.0%(GC) , 4521-28-2
CAS NO.：4521-28-2
Empirical Formula: C11H14O3
Molecular Weight: 194.23
MDL number: MFCD00004404
EINECS: 224-849-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB48.00 | In Stock |
|
| 5G | RMB94.40 | In Stock |
|
| 10g | RMB151.20 | In Stock |
|
| 25G | RMB297.60 | In Stock |
|
| 100G | RMB967.20 | In Stock |
|
| 500g | RMB7199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-59 °C (lit.) |
| Boiling point: | 196 °C / 10mmHg |
| Density | 1.116±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Slightly soluble in methanol. Insoluble in chloroform. |
| pka | 4.76±0.10(Predicted) |
| form | Powder |
| color | Cream to slightly yellow |
| Water Solubility | 994.9g/L(37 ºC) |
| BRN | 2416568 |
| InChI | InChI=1S/C11H14O3/c1-14-10-7-5-9(6-8-10)3-2-4-11(12)13/h5-8H,2-4H2,1H3,(H,12,13) |
| InChIKey | LZHMNCJMXQKSBY-UHFFFAOYSA-N |
| SMILES | C1(CCCC(O)=O)=CC=C(OC)C=C1 |
| LogP | 2.33 |
| CAS DataBase Reference | 4521-28-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-(4-Methoxyphenyl)butyric acid(4521-28-2) |
Description and Uses
4-(4-Methoxyphenyl)butyric acid on demethylation with pyridinium hydrochloride affords 4-hydroxyphenylbutyric acid, a key starting material for the synthesis of preclinical candidate LY518674.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29189900 |
