PRODUCT Properties
| Boiling point: | 78 °C |
| Density | 0.78 |
| refractive index | 1.429-1.432 |
| Flash point: | -28 °C |
| storage temp. | 0-6°C |
| form | Liquid |
| pka | 9.45±0.29(Predicted) |
| color | Clear colorless |
| InChI | InChI=1S/C4H9N/c1-4(2)3-5/h1,3,5H2,2H3 |
| InChIKey | VXDHQYLFEYUMFY-UHFFFAOYSA-N |
| SMILES | C(N)C(C)=C |
| NIST Chemistry Reference | 2-Propen-1-amine, 2-methyl-(2878-14-0) |
Description and Uses
2-Methylallylamine is an intermediate used in the synthesis of urea-containing FK506 binding protein inhibitors. It is also used to prepare benzothiazepine dioxides with HIV-1 protease inhibitory activities. It is dehydrogenated to methacrylonitrile over a silver catalyst. Copolymerization of methallylamine with acrylonitrile increases the affinity of polyacrylonitrile fibers for dyes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi-F,F,Xi,C,Xn |
| Risk Statements | 36/37/38-11-36-22 |
| Safety Statements | 37/39-26-16 |
| RIDADR | 1992 |
| WGK Germany | 3 |
| Hazard Note | Highly Flammable/Irritant |
| HazardClass | FLAMMABLE, CORROSIVE |
| PackingGroup | II |
| HS Code | 29211990 |
