A5665912
2-Methoxy-4-nitrobenzenesulfonyl Chloride , >97.0% , 21320-91-2
CAS NO.：21320-91-2
Empirical Formula: C7H6ClNO5S
Molecular Weight: 251.64
MDL number: MFCD03094697
EINECS: 627-635-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB231.20 | In Stock |
|
| 5G | RMB799.20 | In Stock |
|
| 25g | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-95 °C (lit.) |
| Boiling point: | 406.6±35.0 °C(Predicted) |
| Density | 1.553±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2136023 |
| InChI | 1S/C7H6ClNO5S/c1-14-6-4-5(9(10)11)2-3-7(6)15(8,12)13/h2-4H,1H3 |
| InChIKey | QECYXMKYZQXEHM-UHFFFAOYSA-N |
| SMILES | COc1cc(ccc1S(Cl)(=O)=O)[N+]([O-])=O |
| CAS DataBase Reference | 21320-91-2(CAS DataBase Reference) |
Description and Uses
2-Methoxy-4-nitrobenzenesulfonyl chloride [4-(chlorosulphonyl)-3-methoxynitrobenzene] may be used to synthesize 2-methoxy-4-nitro-N-o-tolyl-benzenesulfonamide.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 34-29-14 |
| Safety Statements | 26-36/37/39-45-8 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Moisture Sensitive |
| HazardClass | IRRITANT, MOISTURE SENSITIVE |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
