A5677412
Monoacetin (contains Di-,Tri-, Glycerol) , >40.0%(GC) , 26446-35-5
CAS NO.:26446-35-5
Empirical Formula: C5H10O4
Molecular Weight: 134.13
MDL number: MFCD00036185
EINECS: 247-704-6
| Pack Size | Price | Stock | Quantity |
| 50ml | RMB127.20 | In Stock |
|
| 100ml | RMB239.20 | In Stock |
|
| 250ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 3 °C |
| Boiling point: | 258 °C |
| Density | 1.21 |
| refractive index | 1.4500 |
| Flash point: | 145 °C |
| Specific Gravity | 1.2060 (20℃) |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| Merck | 14,6242 |
| Exposure limits | OSHA: TWA 15 mg/m3; TWA 5 mg/m3 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| Cosmetic Ingredient Review (CIR) | Monoacetin (26446-35-5) |
| InChI | InChI=1S/C5H10O4/c1-4(7)9-3-5(8)2-6/h5-6,8H,2-3H2,1H3 |
| InChIKey | KMZHZAAOEWVPSE-UHFFFAOYSA-N |
| SMILES | C(O)(CO)COC(=O)C |
| LogP | -1.215 (est) |
| CAS DataBase Reference | 26446-35-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Monoacetine(26446-35-5) |
| EPA Substance Registry System | Glyceryl monoacetate (26446-35-5) |
Description and Uses
Glycerol monoacetate is used for production of tanning leather and dye. It is also used as a solvent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Risk Statements | 68 |
| Safety Statements | 24/25 |
| RTECS | AK3595000 |
| TSCA | TSCA listed |
| Hazardous Substances Data | 26446-35-5(Hazardous Substances Data) |





