A5688112
Monoethyl Malonate , >98.0%(T) , 1071-46-1
Synonym(s):
(Ethoxycarbonyl)acetic acid;3-Ethoxy-3-oxopropanoic acid;Ethyl hydrogen malonate;Ethyl malonate;Monoethyl hydrogen malonate
CAS NO.:1071-46-1
Empirical Formula: C5H8O4
Molecular Weight: 132.11
MDL number: MFCD00020490
EINECS: 213-992-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB43.20 | In Stock |
|
| 10g | RMB68.00 | In Stock |
|
| 25G | RMB118.40 | In Stock |
|
| 100g | RMB397.60 | In Stock |
|
| 500g | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -13°C(lit.) |
| Boiling point: | 106.5 °C/3 mmHg (lit.) |
| Density | 1.119 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly) |
| form | Liquid |
| pka | pK1:3.55 (25°C) |
| color | Pale yellow |
| Water Solubility | Miscible with water, chloroform and other solvents. |
| BRN | 1758845 |
| InChI | InChI=1S/C5H8O4/c1-2-9-5(8)3-4(6)7/h2-3H2,1H3,(H,6,7) |
| InChIKey | HGINADPHJQTSKN-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CC(O)=O |
| CAS DataBase Reference | 1071-46-1(CAS DataBase Reference) |
Description and Uses
Ethyl hydrogen malonate is used as a reactant for the preparation of tetramic acids through Dieckmann ring closure and organocatalytic decarboxylative Doebner-Knoevenagel reactions. It is involved in the acylation reactions and Knoevenagel condensation with aldehydes. It is also used in the preparation of gamma-lactones from olefins by intermolecular carbolactonization in presence of Mn(III) acetate as a catalyst.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29171900 |





