A5711012
Methyl 4-(1<I>H</I>-<WBR>imidazol-<WBR>1-<WBR>yl)<WBR>benzoate , 98% , 101184-08-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB61.60 | In Stock |
|
| 1G | RMB155.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-127 °C (lit.) |
| Boiling point: | 354.7±25.0 °C(Predicted) |
| Density | 1.18±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 5.06±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C11H10N2O2/c1-15-11(14)9-2-4-10(5-3-9)13-7-6-12-8-13/h2-8H,1H3 |
| InChIKey | KUBBZTZQWIGHFH-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(N2C=NC=C2)C=C1 |
Description and Uses
Methyl 4-(1H-imidazol-1-yl)benzoate is a imidazole derivative. It is a heterocyclic building block used in chemical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933299090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
