A5736912
Methyl 2,3-<WBR>dibromopropionate , 97.0%(GC) , 1729-67-5
CAS NO.:1729-67-5
Empirical Formula: C4H6Br2O2
Molecular Weight: 245.9
MDL number: MFCD00017882
EINECS: 217-044-3
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB67.20 | In Stock |
|
| 25g | RMB360.00 | In Stock |
|
| 25ML | RMB1119.20 | In Stock |
|
| 100ML | RMB2959.20 | In Stock |
|
| 500ML | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 83-86 °C/10 mmHg (lit.) |
| Density | 1.944 g/mL at 20 °C (lit.) |
| vapor pressure | 1.3hPa at 20℃ |
| refractive index | n |
| Flash point: | -33 °C |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | 2.6g/L at 20℃ |
| BRN | 1750190 |
| InChI | InChI=1S/C4H6Br2O2/c1-8-4(7)3(6)2-5/h3H,2H2,1H3 |
| InChIKey | ROXQOUUAPQUMLN-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(Br)CBr |
| LogP | 2 |
| CAS DataBase Reference | 1729-67-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyl 2,3-dibromopropionate(1729-67-5) |
| EPA Substance Registry System | Methyl 2,3-dibromopropionate (1729-67-5) |
Description and Uses
Methyl 2,3-dibromopropionate may be used in the preparation of methyl 2-azidoacrylate. It may be used in the preparation of methyl (+)-(1′R, 2R) and (-)-(1′R, 2S)-1-(2-phenylethanol)aziridine-2-carboxylates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37-40-36/37/38-38-11 |
| Safety Statements | 26-36-16-24-9 |
| RIDADR | UN 2398 3/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2916199590 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 STOT SE 3 |






