A5742812
1-Methyl-1<I>H</I>-<WBR>imidazole-<WBR>2-<WBR>carboxylic acid , 90% , 20485-43-2
CAS NO.：20485-43-2
Empirical Formula: C5H6N2O2
Molecular Weight: 126.11
MDL number: MFCD01863421
EINECS: 626-320-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB25.60 | In Stock |
|
| 1G | RMB51.20 | In Stock |
|
| 5g | RMB211.20 | In Stock |
|
| 10g | RMB404.00 | In Stock |
|
| 25g | RMB863.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104 °C (dec.) |
| Boiling point: | 339.4±25.0 °C(Predicted) |
| Density | 1.34±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| pka | 1.24±0.31(Predicted) |
| color | White to Off-White |
| Sensitive | Hygroscopic |
| Stability: | Temperature Sensitive |
| InChI | InChI=1S/C5H6N2O2/c1-7-3-2-6-4(7)5(8)9/h2-3H,1H3,(H,8,9) |
| InChIKey | WLDPWZQYAVZTTP-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)N(C)C=CN=1 |
| CAS DataBase Reference | 20485-43-2(CAS DataBase Reference) |
Description and Uses
1-Methyl-1H-imidazole-2-carboxylic acid is a useful synthetic intermediate for solid phase synthesis of polyamides containing imidazole
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29332900 |
