A5750612
3-Methoxypropionic acid , 96% , 2544-06-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB40.80 | In Stock |
|
| 5g | RMB135.20 | In Stock |
|
| 10G | RMB239.20 | In Stock |
|
| 25g | RMB552.80 | In Stock |
|
| 50G | RMB1039.20 | In Stock |
|
| 100g | RMB1999.20 | In Stock |
|
| 500g | RMB6014.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 116 °C/9 mmHg (lit.) |
| Density | 1.108 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Chloroform, Methanol |
| form | liquid |
| pka | 4.29±0.10(Predicted) |
| Specific Gravity | 1.108 |
| color | Colourless |
| BRN | 1743053 |
| InChI | InChI=1S/C4H8O3/c1-7-3-2-4(5)6/h2-3H2,1H3,(H,5,6) |
| InChIKey | YSIKHBWUBSFBRZ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCOC |
Description and Uses
m-PEG1-acid is a PEG linker containing a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The hydrophilic PEG spacer increases solubility in aqueous media.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2918999090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





