A5751212
2-<WBR>Methyl-<WBR>4-<WBR>(trifluoromethoxy)<WBR>bromobenzene , 97% , 261951-96-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB276.00 | In Stock |
|
| 5g | RMB839.20 | In Stock |
|
| 25g | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 197.9±35.0 °C(Predicted) |
| Density | 1.559 g/mL at 25 °C |
| refractive index | n 20/D 1.469 |
| Flash point: | 78 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Clear colourless |
| InChI | InChI=1S/C8H6BrF3O/c1-5-4-6(2-3-7(5)9)13-8(10,11)12/h2-4H,1H3 |
| InChIKey | ZKABPUGKDKWJIP-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(OC(F)(F)F)C=C1C |
Description and Uses
1-Bromo-2-methyl-4-(trifluoromethoxy)benzene is used to prepare acetyl-CoA carboxylase inhibitors for metabolic syndrome treatment.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H319-H411 |
| Precautionary statements | P273-P305+P351+P338 |
| Hazard Codes | Xi,N |
| Risk Statements | 51/53 |
| Safety Statements | 61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2909309090 |








