PRODUCT Properties
| Melting point: | 158-159℃ |
| Boiling point: | 495.4±45.0 °C(Predicted) |
| Density | 1.532±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Water (Slightly, Sonicated) |
| form | Solid |
| pka | 11.28±0.20(Predicted) |
| color | Pale Brown to Light Brown |
| Stability: | Hygroscopic, Unstable In Acidic Solution |
| InChI | InChI=1S/C7H12O7/c1-14-7(13)6(12)5(11)4(10)3(9)2-8/h3-5,8-11H,2H2,1H3/t3-,4+,5-/m0/s1 |
| InChIKey | KPHIBLNUVRGOGU-LMVFSUKVSA-N |
| SMILES | C(OC)(=O)C([C@H]([C@@H]([C@H](CO)O)O)O)=O |
Description and Uses
L-xylo-2-Hexulosonic Acid, Methyl Ester is an intermediate in the synthesis of Vitamin C (A786990),a physiological antioxidant, an essential nutrients and a cofactor in various enzyme catalyzed reactions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |





