A5764212
Methyl 4-<WBR>acetamido-<WBR>5-<WBR>chloro-<WBR>2-<WBR>methoxybenzoate , 99% , 4093-31-6
Synonym(s):
Methyl 4-acetamido-5-chloro-2-methoxybenzoate
CAS NO.:4093-31-6
Empirical Formula: C11H12ClNO4
Molecular Weight: 257.67
MDL number: MFCD00048191
EINECS: 223-840-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB29.60 | In Stock |
|
| 5g | RMB37.60 | In Stock |
|
| 10g | RMB70.40 | In Stock |
|
| 25G | RMB118.40 | In Stock |
|
| 50g | RMB183.20 | In Stock |
|
| 100g | RMB348.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-156 °C |
| Boiling point: | 440.2±45.0 °C(Predicted) |
| Density | 1.3248 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.16±0.70(Predicted) |
| color | White to Off-White |
| Water Solubility | 1.14g/L at 25℃ |
| InChI | InChI=1S/C11H12ClNO4/c1-6(14)13-9-5-10(16-2)7(4-8(9)12)11(15)17-3/h4-5H,1-3H3,(H,13,14) |
| InChIKey | OUEXNQRVYGYGIK-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC(Cl)=C(NC(C)=O)C=C1OC |
| LogP | 1.49 at 20℃ |
| CAS DataBase Reference | 4093-31-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 4-(acetylamino)-5-chloro-2-methoxy-, methyl ester (4093-31-6) |
Description and Uses
Methyl 4-Acetylamino-5-chloro-2-methoxybenzoate is an biotransformed metabolite of Metoclopramide (M338685), an dopamine D2 receptor antagonist and antiemetic agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |




