A5767012
Methyl 1H-<WBR>indazole-<WBR>5-<WBR>carboxylate , 473416-12-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB29.60 | In Stock |
|
| 1G | RMB41.60 | In Stock |
|
| 5g | RMB145.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 345.2±15.0 °C(Predicted) |
| Density | 1.324±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 12.81±0.40(Predicted) |
| form | solid |
| color | Orange |
| InChI | InChI=1S/C9H8N2O2/c1-13-9(12)6-2-3-8-7(4-6)5-10-11-8/h2-5H,1H3,(H,10,11) |
| InChIKey | LPLOEZPPYOSNEW-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(C(OC)=O)C=C2)C=N1 |
Description and Uses
5-(1H)INDAZOLE CARBOXYLIC ACID METHYL ESTER is a versatile compound commonly utilized in chemical synthesis as a key building block for the creation of various organic molecules.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |







