A5843112
methyl 6-bromopyridine-3-carboxylate , 97% , 26218-78-0
CAS NO.:26218-78-0
Empirical Formula: C7H6BrNO2
Molecular Weight: 216.03
MDL number: MFCD04972371
EINECS: 676-047-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB295.20 | In Stock |
|
| 100g | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 119-121 |
| Boiling point: | 107-110 °C(Press: 4 Torr) |
| Density | 1.579±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| form | powder to crystal |
| pka | -1.25±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H6BrNO2/c1-11-7(10)5-2-3-6(8)9-4-5/h2-4H,1H3 |
| InChIKey | NFLROFLPSNZIAH-UHFFFAOYSA-N |
| SMILES | C1=NC(Br)=CC=C1C(OC)=O |
| CAS DataBase Reference | 26218-78-0(CAS DataBase Reference) |
Description and Uses
A potential hypolipidemic agent; a nicotinic acid analog. Heterocyclic compounds affecting free fatty acid mobilization in vivo.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |







