A5846112
2-methoxypyrimidin-4-amine , 97% , 3289-47-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB71.20 | In Stock |
|
| 1G | RMB143.20 | In Stock |
|
| 5g | RMB584.80 | In Stock |
|
| 10g | RMB1037.60 | In Stock |
|
| 25g | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174 °C |
| Boiling point: | 294.4±32.0 °C(Predicted) |
| Density | 1.224 |
| storage temp. | 2-8°C(protect from light) |
| solubility | DMSO: 60 mg/mL (479.50 mM) |
| pka | 4.97±0.10(Predicted) |
| form | solid |
| color | White to off white |
| InChI | InChI=1S/C5H7N3O/c1-9-5-7-3-2-4(6)8-5/h2-3H,1H3,(H2,6,7,8) |
| InChIKey | DHYLZDVDOQLEAQ-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC=CC(N)=N1 |
Description and Uses
2-O-Methylcytosine, an O-alkylated analogue a DNA adduct, is the damaged nucleobase[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-36-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
