A5859912
methyl 5-bromothiophene-2-carboxylate , 97% , 62224-19-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB31.20 | In Stock |
|
| 5g | RMB103.20 | In Stock |
|
| 25g | RMB439.20 | In Stock |
|
| 100g | RMB1583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-88℃ |
| Boiling point: | 251.9±20.0 °C(Predicted) |
| Density | 1.662±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| Appearance | Off-white to light brown Solid |
| InChI | InChI=1S/C6H5BrO2S/c1-9-6(8)4-2-3-5(7)10-4/h2-3H,1H3 |
| InChIKey | QLWUHAQCKDHUNL-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)SC(Br)=CC=1 |
Description and Uses
Methyl 5-Bromo-2-thiophenecarboxylate is used as a reagent in the synthesis of trisubstituted isoxazole derivatives which are novel nonsteroidal antagonists of Farnesoid X Receptor (FXR). FXR plays an important role in regulation of cholesterol, lipid and glucose metabolism.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P271-P260-P280 |
| HS Code | 2932990090 |
