A5860212
(2-methoxypyrimidin-5-yl)boronic acid , 97% , 628692-15-9
CAS NO.：628692-15-9
Empirical Formula: C5H7BN2O3
Molecular Weight: 153.93
MDL number: MFCD03094664
EINECS: 670-240-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5g | RMB239.20 | In Stock |
|
| 10g | RMB399.20 | In Stock |
|
| 25g | RMB799.20 | In Stock |
|
| 100g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 161°C(lit.) |
| Boiling point: | 378.3±52.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 5.59±0.11(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C5H7BN2O3/c1-11-5-7-2-4(3-8-5)6(9)10/h2-3,9-10H,1H3 |
| InChIKey | YPWAJLGHACDYQS-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(OC)N=C1)(O)O |
| CAS DataBase Reference | 628692-15-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36-41-36/37/38 |
| Safety Statements | 26-39-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
