A5864712
5-methylthiophene-2-carbonitrile , 95% , 72835-25-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB260.00 | In Stock |
|
| 5G | RMB972.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 73 °C |
| Density | 1.16±0.1 g/cm3(Predicted) |
| refractive index | 1.5540 to 1.5580 |
| Flash point: | 86° |
| storage temp. | 2-8°C(protect from light) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C6H5NS/c1-5-2-3-6(4-7)8-5/h2-3H,1H3 |
| InChIKey | RBQRZWYCXAXPIN-UHFFFAOYSA-N |
| SMILES | C1(C#N)SC(C)=CC=1 |
Description and Uses
5-methylthiophene-2-carbonitrile can be used in pharmaceutical synthesis and scientific research.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H227 |
| Precautionary statements | P501-P261-P270-P210-P271-P264-P280-P370+P378-P337+P313-P305+P351+P338-P361+P364-P332+P313-P301+P310+P330-P302+P352+P312-P304+P340+P311-P403+P233-P403+P235-P405 |
| RIDADR | UN 3276 6.1/PG III |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2934999090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




![5-CYANO-N-(([(2-FLUOROBENZYL)OXY]IMINO)METHYL)-3-METHYL-4-PHENYL-2-THIOPHENECARBOXAMIDE](https://img.chemicalbook.com/StructureFile/ChemBookStructure3/GIF/CB8354859.gif)

