A5955112
Methyl 5-methylpyrazine-2-carboxylate , 98% , 41110-33-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB59.04 | In Stock |
|
| 5g | RMB181.60 | In Stock |
|
| 25g | RMB618.40 | In Stock |
|
| 100g | RMB1960.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92 °C |
| Boiling point: | 234.1±35.0 °C(Predicted) |
| Density | 1.169±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Dichloromethane, Methanol |
| form | Solid |
| pka | -0.23±0.10(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C7H8N2O2/c1-5-3-9-6(4-8-5)7(10)11-2/h3-4H,1-2H3 |
| InChIKey | CRBOSZMVDHYLJE-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NC=C(C)N=C1 |
Description and Uses
Methyl 5-methylpyrazine-2-carboxylate is an intermediate in the synthesis of 4-[β-(5-Methylpyrazinyl-2-carboxamido)ethyl]benzene Sulfonamide which itself is an intermediate in the synthesis of Glipizide (G410225).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2933998090 |
