A5956612
6-(Methylamino)purine , 95% , 443-72-1
CAS NO.:443-72-1
Empirical Formula: C6H7N5
Molecular Weight: 149.15
MDL number: MFCD00075820
EINECS: 207-137-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB207.20 | In Stock |
|
| 1G | RMB574.40 | In Stock |
|
| 5G | RMB1737.60 | In Stock |
|
| 25G | RMB4835.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C |
| Boiling point: | 256.3±50.0 °C(Predicted) |
| Density | 1.57±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 9.61±0.20(Predicted) |
| color | White to Light Grey |
| Major Application | general analytical life science and biopharma metabolomics |
| InChI | InChI=1S/C6H7N5/c1-7-5-4-6(10-2-8-4)11-3-9-5/h2-3H,1H3,(H2,7,8,9,10,11) |
| InChIKey | CKOMXBHMKXXTNW-UHFFFAOYSA-N |
| SMILES | N1=CN=C(NC)C=2NC=NC12 |
| CAS DataBase Reference | 443-72-1 |
Description and Uses
N6-Methyladenine is a modified purine that is commonly found in genomes of prokaryotes, protists, and plants. It is less common in higher eukaryotes and extremely rare in mammals. Like methylation of other DNA residues, N6-methyladenine represents an epigenetic modification that can affect diverse DNA functions, including replication, repair, and expression.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 2933998090 |







