A5970912
6-Methylquinoxaline , 98% , 6344-72-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB158.40 | In Stock |
|
| 5G | RMB599.20 | In Stock |
|
| 25G | RMB2336.00 | In Stock |
|
| 100G | RMB2888.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218.5°C |
| Boiling point: | 244-245°C |
| Density | 1.1164 |
| refractive index | 1.6190 |
| Flash point: | 244-245°C |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 1.40±0.30(Predicted) |
| Appearance | Light yellow to brown Liquid |
| BRN | 113371 |
| InChI | InChI=1S/C9H8N2/c1-7-2-3-8-9(6-7)11-5-4-10-8/h2-6H,1H3 |
| InChIKey | OSRARURJYPOUOV-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(C)=CC=2)N=CC=1 |
| LogP | 1.872 (est) |
| CAS DataBase Reference | 6344-72-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Quinoxaline, 6-methyl-(6344-72-5) |
Description and Uses
6-Methylquinoxaline (CAS# 6344-72-5) can be used as a conductive roller for electrophotographic apparatus. It has also be known for its sequential synthesis, olfactory properties, and biological activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| Hazard Codes | Xn,Xi,C,F |
| Risk Statements | 22-36/37/38-34-11 |
| Safety Statements | 23-26-36/37/39-45-16 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
