A6022712
Methylene Blue hydrate , 96% , 122965-43-9
CAS NO.：122965-43-9
Empirical Formula: C16H20ClN3OS
Molecular Weight: 337.87
MDL number: MFCD00150006
EINECS: 602-909-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB48.80 | In Stock |
|
| 25G | RMB119.20 | In Stock |
|
| 100G | RMB303.20 | In Stock |
|
| 500g | RMB1063.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190 °C |
| storage temp. | 2-8°C |
| solubility | H2O: soluble4mg/4ml |
| Colour Index | 52015 |
| form | Fine Crystalline Powder |
| color | Green |
| Water Solubility | Soluble in water, alcohol, acetic acid, glycerol and chloroform. Insoluble in ether. |
| λmax | 661 nm |
| Merck | 14,6060 |
| BRN | 3599847 |
| Major Application | hematology histology pharmaceutical (small molecule) |
| InChI | InChI=1S/C16H18N3S.ClH.H2O/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;;/h5-10H,1-4H3;1H;1H2/q+1;;/p-1 |
| InChIKey | WQVSELLRAGBDLX-UHFFFAOYSA-M |
| SMILES | N(C1C=CC2=NC3=CC=C(N(C)C)C=C3[S+]=C2C=1)(C)C.[Cl-].O |
Description and Uses
Methylene blue is used as a dye for a number of different staining procedures, such as Wright's stain and Jenner's stain. Since it is a temporary staining technique, methylene blue can also be used to examine RNA or DNA under the microscope or in a gel. I
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 26-39-61 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | SO5600000 |
| TSCA | Yes |
| HS Code | 32041300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
