A6051612
Methyltris(methylethylketoxime)silane , 93% , 22984-54-9
CAS NO.：22984-54-9
Empirical Formula: C13H27N3O3Si
Molecular Weight: 301.46
MDL number: MFCD00053889
EINECS: 245-366-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB32.00 | In Stock |
|
| 25G | RMB55.20 | In Stock |
|
| 100G | RMB143.20 | In Stock |
|
| 500G | RMB479.20 | In Stock |
|
| 2.5kg | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -22°C |
| Boiling point: | 110 °C |
| Density | 0.982 |
| vapor pressure | 0.142Pa at 25℃ |
| refractive index | 1.4548 [25°C] |
| Flash point: | 90°C |
| Specific Gravity | 0.982 |
| Odor | Mild odor |
| Water Solubility | 36.63g/L |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C13H27N3O3Si/c1-8-11(4)14-17-20(7,18-15-12(5)9-2)19-16-13(6)10-3/h8-10H2,1-7H3/b14-11-,15-12+,16-13+ |
| InChIKey | OGZPYBBKQGPQNU-STFOEXHGSA-N |
| SMILES | [Si](C)(O/N=C(\C)/CC)(O/N=C(\C)/CC)O/N=C(/C)\CC |
| LogP | 1.69 |
| CAS DataBase Reference | 22984-54-9(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Butanone, 2,2',2''-[O,O',O''-(methylsilylidyne)trioxime] (22984-54-9) |
Description and Uses
Methyltris(methylethylketoxime)silane can be used as a silane coupling agent and crosslinker.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H317 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
| Risk Statements | 20/21/22-36/37/38-22-20 |
| Safety Statements | 23-26-36/37/39 |
| RIDADR | 1993 |
| TSCA | Yes |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29319090 |
