A6145712
p-Nitrophenyl-β-D-Galactopyranoside , 99% , 3150-24-1
Synonym(s):
p-Nitrophenyl β-D -galacto-pyran-oside
CAS NO.:3150-24-1
Empirical Formula: C12H15NO8
Molecular Weight: 301.25
MDL number: MFCD00063256
EINECS: 221-584-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB216.80 | In Stock |
|
| 5G | RMB719.20 | In Stock |
|
| 25G | RMB1511.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178-182 °C |
| Boiling point: | 442.39°C (rough estimate) |
| alpha | [α]D20 -79~-85° (c=2, H2O)(calculated on the dried basis) |
| Density | 1.3709 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMF: 11 mg/ml; DMSO: 10 mg/ml; Ethanol: Slightly soluble; PBS (pH 7.2): 0.09 mg/ml |
| pka | 12.55±0.70(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Soluble in DMSO, Methanol, Water. |
| BRN | 92213 |
| InChI | 1S/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9+,10+,11-,12-/m1/s1 |
| InChIKey | IFBHRQDFSNCLOZ-AUCPDYOHSA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2ccc(cc2)[N+]([O-])=O)[C@H](O)[C@@H](O)[C@H]1O |
| LogP | -0.590 |
| CAS DataBase Reference | 3150-24-1(CAS DataBase Reference) |
Description and Uses
p-Nitrophenyl-β-D-galactopyranoside (cas# 3150-24-1) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |




