A6146112
4-Nitrobenzyl chloride , CP , 100-14-1
Synonym(s):
α-Chloro-4-nitrotoluene
CAS NO.:100-14-1
Empirical Formula: C7H6ClNO2
Molecular Weight: 171.58
MDL number: MFCD00007374
EINECS: 202-822-7
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71 °C |
| Boiling point: | 112 °C (0.6 mmHg) |
| Density | 1.3246 (rough estimate) |
| refractive index | 1.5647 (estimate) |
| solubility | chloroform: soluble50mg/mL, clear to very slightly hazy, faintly yellow |
| form | Crystalline Needles or Powder |
| color | Light yellow |
| BRN | 387187 |
| Stability: | Stable. Incompatible with strong oxidizing agents, bases, amines, moisture, alcohols. Corrodes steel. Reacts slowly with water. Combustible. |
| InChI | 1S/C7H6ClNO2/c8-5-6-1-3-7(4-2-6)9(10)11/h1-4H,5H2 |
| InChIKey | KGCNHWXDPDPSBV-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(CCl)cc1 |
| CAS DataBase Reference | 100-14-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Nitrobenzyl chloride(100-14-1) |
| EPA Substance Registry System | 1-(Chloromethyl)-4-nitrobenzene (100-14-1) |
Description and Uses
Benzene, 1-(chloromethyl)-4-nitro- is a crystalline solid. Molecular weight= 171.58; Freezing/Meltingpoint =71℃. Slightly soluble in water; slow reaction.
4-Nitrobenzyl chloride was used to prepare unsymmetrically N,N′-bis(substituted) 4,13-diaza-18-crown-6-ether derivatives.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 22-34-36 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | XS9093000 |
| F | 4.8-19-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |
| Hazardous Substances Data | 100-14-1(Hazardous Substances Data) |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




