A6146712
p-Nitrophenyl palmitate , 98% , 1492-30-4
Synonym(s):
p-Nitrophenyl palmitate;Hexadecanoic acid 4-nitrophenyl ester
CAS NO.:1492-30-4
Empirical Formula: C22H35NO4
Molecular Weight: 377.52
MDL number: MFCD00047732
EINECS: 216-084-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB103.20 | In Stock |
|
| 5G | RMB324.00 | In Stock |
|
| 25G | RMB1102.40 | In Stock |
|
| 100G | RMB3142.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-66°C |
| Boiling point: | 483.6±28.0 °C(Predicted) |
| Density | 1.020±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMF: 1 mg/ml |
| form | A solid |
| color | White to off-white |
| Water Solubility | Insoluble in water. Soluble in CHCl3. |
| BRN | 1891754 |
| InChI | InChI=1S/C22H35NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-22(24)27-21-18-16-20(17-19-21)23(25)26/h16-19H,2-15H2,1H3 |
| InChIKey | LVZSQWIWCANHPF-UHFFFAOYSA-N |
| SMILES | C(OC1=CC=C([N+]([O-])=O)C=C1)(=O)CCCCCCCCCCCCCCC |
| CAS DataBase Reference | 1492-30-4(CAS DataBase Reference) |
Description and Uses
4-Nitrophenyl Palmitate is used in immobilization method of lipase interface based on natural polysaccharide particles.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 29157090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |



