A6150612
2-Nitrofluorene , 98% , 607-57-8
CAS NO.:607-57-8
Empirical Formula: C13H9NO2
Molecular Weight: 211.22
MDL number: MFCD00001117
EINECS: 210-138-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB26.40 | In Stock |
|
| 5G | RMB80.00 | In Stock |
|
| 25G | RMB300.00 | In Stock |
|
| 100g | RMB1016.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156-158 °C (lit.) |
| Boiling point: | 350.9°C (rough estimate) |
| Density | 1.1868 (rough estimate) |
| refractive index | 1.6060 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Powder |
| color | White to brown |
| Water Solubility | Insoluble |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C13H9NO2/c15-14(16)11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2 |
| InChIKey | XFOHWECQTFIEIX-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)C2=C1C=C([N+]([O-])=O)C=C2 |
| CAS DataBase Reference | 607-57-8(CAS DataBase Reference) |
| IARC | 2B (Vol. 46, 105) 2014 |
| NIST Chemistry Reference | Fluorene, 2-nitro-(607-57-8) |
| EPA Substance Registry System | 2-Nitrofluorene (607-57-8) |
Description and Uses
2-Nitrofluorene is a genotoxic compound and also a biomaker that affects the DNA of living organisms. An environmental pollutant.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H351-H411 |
| Precautionary statements | P201-P273-P308+P313 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,N |
| Risk Statements | 40-51/53-68 |
| Safety Statements | 36/37-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | LL8225000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29042000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 Carc. 2 |
| Hazardous Substances Data | 607-57-8(Hazardous Substances Data) |






