A6150812
1-Naphthalenemethanol , 98% , 4780-79-4
CAS NO.：4780-79-4
Empirical Formula: C11H10O
Molecular Weight: 158.2
MDL number: MFCD00004044
EINECS: 225-324-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB22.40 | In Stock |
|
| 5G | RMB34.40 | In Stock |
|
| 10G | RMB50.40 | In Stock |
|
| 25G | RMB119.20 | In Stock |
|
| 50G | RMB232.00 | In Stock |
|
| 100G | RMB463.20 | In Stock |
|
| 500g | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-63 °C (lit.) |
| Boiling point: | 301 °C/715 mmHg (lit.) |
| Density | 1.1039 |
| refractive index | 1.5440 (estimate) |
| Flash point: | 301°C/715mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| pka | 14.22±0.10(Predicted) |
| form | Fine Crystalline Powder |
| color | Yellow |
| BRN | 2042532 |
| InChI | InChI=1S/C11H10O/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7,12H,8H2 |
| InChIKey | PBLNHHSDYFYZNC-UHFFFAOYSA-N |
| SMILES | C1(CO)=C2C(C=CC=C2)=CC=C1 |
| CAS DataBase Reference | 4780-79-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Naphthalenemethanol(4780-79-4) |
Description and Uses
1-Naphthalenemethanol was used to investigate UV photooxidation of 1-methylnaphthalene in the presence of dry or humid air.
